C15H25BrN4 — CID 133373826
5-bromo-N-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-3-methylpyridin-2-amine (PubChem CID 133373826) has the molecular formula C15H25BrN4 and a molecular weight of 341.30 g/mol. Its IUPAC name is 5-bromo-N-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-3-methylpyridin-2-amine.
| Compound Name | 5-bromo-N-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 133373826 |
| Molecular Formula | C15H25BrN4 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-bromo-N-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-3-methylpyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1NC1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C15H25BrN4/c1-12-10-13(16)11-17-15(12)18-14-4-6-20(7-5-14)9-8-19(2)3/h10-11,14H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | BXPYTLMTXKGENX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |