C20H30N4O3 — CID 133352908
propan-2-yl 4-[[3-(piperidine-1-carbonyl)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 133352908) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is propan-2-yl 4-[[3-(piperidine-1-carbonyl)-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[3-(piperidine-1-carbonyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 133352908 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | propan-2-yl 4-[[3-(piperidine-1-carbonyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(Nc2ncccc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-15(2)27-20(26)24-13-8-16(9-14-24)22-18-17(7-6-10-21-18)19(25)23-11-4-3-5-12-23/h6-7,10,15-16H,3-5,8-9,11-14H2,1-2H3,(H,21,22) |
| InChIKey | AOLQRPRCUREMAR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |