C27H34ClN3O2 — CID 46027501
N-(3-chlorophenyl)-2-cyclopentyl-2-[4-(2-phenylbutanoyl)piperazin-1-yl]acetamide (PubChem CID 46027501) has the molecular formula C27H34ClN3O2 and a molecular weight of 468.04 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-cyclopentyl-2-[4-(2-phenylbutanoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-cyclopentyl-2-[4-(2-phenylbutanoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46027501 |
| Molecular Formula | C27H34ClN3O2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | N-(3-chlorophenyl)-2-cyclopentyl-2-[4-(2-phenylbutanoyl)piperazin-1-yl]acetamide |
| SMILES | CCC(C(=O)N1CCN(C(C(=O)Nc2cccc(Cl)c2)C2CCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H34ClN3O2/c1-2-24(20-9-4-3-5-10-20)27(33)31-17-15-30(16-18-31)25(21-11-6-7-12-21)26(32)29-23-14-8-13-22(28)19-23/h3-5,8-10,13-14,19,21,24-25H,2,6-7,11-12,15-18H2,1H3,(H,29,32) |
| InChIKey | DBXMEHXHYFNOLV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |