C30H41N3O2 — CID 46027567
2-cyclopentyl-2-[4-(2-phenylbutanoyl)piperazin-1-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 46027567) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-(2-phenylbutanoyl)piperazin-1-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-cyclopentyl-2-[4-(2-phenylbutanoyl)piperazin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46027567 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | 2-cyclopentyl-2-[4-(2-phenylbutanoyl)piperazin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CCC(C(=O)N1CCN(C(C(=O)Nc2ccc(C(C)C)cc2)C2CCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C30H41N3O2/c1-4-27(24-10-6-5-7-11-24)30(35)33-20-18-32(19-21-33)28(25-12-8-9-13-25)29(34)31-26-16-14-23(15-17-26)22(2)3/h5-7,10-11,14-17,22,25,27-28H,4,8-9,12-13,18-21H2,1-3H3,(H,31,34) |
| InChIKey | AORRLBCYCNIYPX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |