C22H33ClN4O2 — CID 46027296
N-(3-chlorophenyl)-4-[1-cyclopentyl-2-(diethylamino)-2-oxoethyl]piperazine-1-carboxamide (PubChem CID 46027296) has the molecular formula C22H33ClN4O2 and a molecular weight of 420.99 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[1-cyclopentyl-2-(diethylamino)-2-oxoethyl]piperazine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-[1-cyclopentyl-2-(diethylamino)-2-oxoethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 46027296 |
| Molecular Formula | C22H33ClN4O2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-(3-chlorophenyl)-4-[1-cyclopentyl-2-(diethylamino)-2-oxoethyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)C(C1CCCC1)N1CCN(C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H33ClN4O2/c1-3-25(4-2)21(28)20(17-8-5-6-9-17)26-12-14-27(15-13-26)22(29)24-19-11-7-10-18(23)16-19/h7,10-11,16-17,20H,3-6,8-9,12-15H2,1-2H3,(H,24,29) |
| InChIKey | GUUCNHQPHJNADZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |