C23H28ClN3O2S — CID 42843618
N-(3-chlorophenyl)-2-cyclopentyl-2-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]acetamide (PubChem CID 42843618) has the molecular formula C23H28ClN3O2S and a molecular weight of 446.02 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-cyclopentyl-2-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-cyclopentyl-2-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 42843618 |
| Molecular Formula | C23H28ClN3O2S |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-(3-chlorophenyl)-2-cyclopentyl-2-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]acetamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(C1CCCC1)N1CCN(C(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C23H28ClN3O2S/c24-18-7-3-8-19(15-18)25-23(29)22(17-5-1-2-6-17)27-12-10-26(11-13-27)21(28)16-20-9-4-14-30-20/h3-4,7-9,14-15,17,22H,1-2,5-6,10-13,16H2,(H,25,29) |
| InChIKey | ALFQRNZTELHSHX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |