C26H32N4O6 — CID 90914348
[(3R)-1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamic acid (PubChem CID 90914348) has the molecular formula C26H32N4O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is [(3R)-1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamic acid.
| Compound Name | [(3R)-1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 90914348 |
| Molecular Formula | C26H32N4O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | [(3R)-1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamic acid |
| SMILES | COc1cccc(CN2CC[C@@H](N(C(=O)O)c3ccc(C=CC(=O)NOC4CCCCO4)cn3)C2)c1 |
| InChI | InChI=1S/C26H32N4O6/c1-34-22-6-4-5-20(15-22)17-29-13-12-21(18-29)30(26(32)33)23-10-8-19(16-27-23)9-11-24(31)28-36-25-7-2-3-14-35-25/h4-6,8-11,15-16,21,25H,2-3,7,12-14,17-18H2,1H3,(H,28,31)(H,32,33)/t21-,25?/m1/s1 |
| InChIKey | FYWCQNADGOHFGG-JGKWMGOWSA-N |
| XLogP | 3.44 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|