C27H40N4O5 — CID 140500643
tert-butyl N-[(3R)-1-cyclopentylpyrrolidin-3-yl]-N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamate (PubChem CID 140500643) has the molecular formula C27H40N4O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-cyclopentylpyrrolidin-3-yl]-N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-cyclopentylpyrrolidin-3-yl]-N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 140500643 |
| Molecular Formula | C27H40N4O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | tert-butyl N-[(3R)-1-cyclopentylpyrrolidin-3-yl]-N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(/C=C/C(=O)NOC2CCCCO2)cn1)[C@@H]1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C27H40N4O5/c1-27(2,3)35-26(33)31(22-15-16-30(19-22)21-8-4-5-9-21)23-13-11-20(18-28-23)12-14-24(32)29-36-25-10-6-7-17-34-25/h11-14,18,21-22,25H,4-10,15-17,19H2,1-3H3,(H,29,32)/b14-12+/t22-,25?/m1/s1 |
| InChIKey | QWGQBQGGEZRXIY-LJTFAHCISA-N |
| XLogP | 4.43 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|