C30H40N4O6 — CID 91547921
tert-butyl N-[(3R)-1-[(2-methoxyphenyl)methyl]pyrrolidin-3-yl]-N-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamate (PubChem CID 91547921) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(2-methoxyphenyl)methyl]pyrrolidin-3-yl]-N-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(2-methoxyphenyl)methyl]pyrrolidin-3-yl]-N-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 91547921 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(2-methoxyphenyl)methyl]pyrrolidin-3-yl]-N-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamate |
| SMILES | COc1ccccc1CN1CC[C@@H](N(C(=O)OC(C)(C)C)c2ccc(C=CC(=O)NOC3CCCCO3)cn2)C1 |
| InChI | InChI=1S/C30H40N4O6/c1-30(2,3)39-29(36)34(24-16-17-33(21-24)20-23-9-5-6-10-25(23)37-4)26-14-12-22(19-31-26)13-15-27(35)32-40-28-11-7-8-18-38-28/h5-6,9-10,12-15,19,24,28H,7-8,11,16-18,20-21H2,1-4H3,(H,32,35)/t24-,28?/m1/s1 |
| InChIKey | YBLQYOFPZBAFIA-RIBGEGAISA-N |
| XLogP | 4.69 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|