C32H48N4O5 — CID 86603833
tert-butyl N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]-N-[(3R)-1-[(2,6,6-trimethylcyclohexen-1-yl)methyl]pyrrolidin-3-yl]carbamate (PubChem CID 86603833) has the molecular formula C32H48N4O5 and a molecular weight of 568.76 g/mol. Its IUPAC name is tert-butyl N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]-N-[(3R)-1-[(2,6,6-trimethylcyclohexen-1-yl)methyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]-N-[(3R)-1-[(2,6,6-trimethylcyclohexen-1-yl)methyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86603833 |
| Molecular Formula | C32H48N4O5 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | tert-butyl N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]-N-[(3R)-1-[(2,6,6-trimethylcyclohexen-1-yl)methyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC1=C(CN2CC[C@@H](N(C(=O)OC(C)(C)C)c3ccc(/C=C/C(=O)NOC4CCCCO4)cn3)C2)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H48N4O5/c1-23-10-9-17-32(5,6)26(23)22-35-18-16-25(21-35)36(30(38)40-31(2,3)4)27-14-12-24(20-33-27)13-15-28(37)34-41-29-11-7-8-19-39-29/h12-15,20,25,29H,7-11,16-19,21-22H2,1-6H3,(H,34,37)/b15-13+/t25-,29?/m1/s1 |
| InChIKey | ZPMMOGYXKRVNBK-GWFMMDOUSA-N |
| XLogP | 6.01 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|