C26H37N3O4 — CID 91385805
ethyl 3-[6-[[(3R)-1-(cyclohexen-1-ylmethyl)pyrrolidin-3-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 91385805) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is ethyl 3-[6-[[(3R)-1-(cyclohexen-1-ylmethyl)pyrrolidin-3-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | ethyl 3-[6-[[(3R)-1-(cyclohexen-1-ylmethyl)pyrrolidin-3-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 91385805 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | ethyl 3-[6-[[(3R)-1-(cyclohexen-1-ylmethyl)pyrrolidin-3-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(N(C(=O)OC(C)(C)C)[C@@H]2CCN(CC3=CCCCC3)C2)nc1 |
| InChI | InChI=1S/C26H37N3O4/c1-5-32-24(30)14-12-20-11-13-23(27-17-20)29(25(31)33-26(2,3)4)22-15-16-28(19-22)18-21-9-7-6-8-10-21/h9,11-14,17,22H,5-8,10,15-16,18-19H2,1-4H3/t22-/m1/s1 |
| InChIKey | SXUORHIQUGLKBD-JOCHJYFZSA-N |
| XLogP | 4.97 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|