C20H29N5O4 — CID 90839485
(2R)-N-cyclopentyl-2-[[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]propanamide (PubChem CID 90839485) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-[[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]propanamide.
| Compound Name | (2R)-N-cyclopentyl-2-[[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 90839485 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (2R)-N-cyclopentyl-2-[[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]propanamide |
| SMILES | C[C@@H](Nc1cnc(C=CC(=O)NOC2CCCCO2)cn1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H29N5O4/c1-14(20(27)24-15-6-2-3-7-15)23-17-13-21-16(12-22-17)9-10-18(26)25-29-19-8-4-5-11-28-19/h9-10,12-15,19H,2-8,11H2,1H3,(H,22,23)(H,24,27)(H,25,26)/t14-,19?/m1/s1 |
| InChIKey | YMEOAPTYMVAKER-MJTSIZKDSA-N |
| XLogP | 1.92 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|