C23H23ClN2O4 — CID 91196490
3-[5-[3-[4-(chloromethyl)phenyl]-3-oxoprop-1-enyl]-2-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 91196490) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is 3-[5-[3-[4-(chloromethyl)phenyl]-3-oxoprop-1-enyl]-2-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | 3-[5-[3-[4-(chloromethyl)phenyl]-3-oxoprop-1-enyl]-2-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 91196490 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-[5-[3-[4-(chloromethyl)phenyl]-3-oxoprop-1-enyl]-2-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(C=CC(=O)c2ccc(CCl)cc2)cn1)NOC1CCCCO1 |
| InChI | InChI=1S/C23H23ClN2O4/c24-15-17-4-8-19(9-5-17)21(27)12-7-18-6-10-20(25-16-18)11-13-22(28)26-30-23-3-1-2-14-29-23/h4-13,16,23H,1-3,14-15H2,(H,26,28) |
| InChIKey | OIHIJKKUUAFBDI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|