C25H28Cl2N4O4 — CID 87636579
(E)-3-[5-chloro-6-[[1-(4-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 87636579) has the molecular formula C25H28Cl2N4O4 and a molecular weight of 519.43 g/mol. Its IUPAC name is (E)-3-[5-chloro-6-[[1-(4-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-6-[[1-(4-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 87636579 |
| Molecular Formula | C25H28Cl2N4O4 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (E)-3-[5-chloro-6-[[1-(4-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnc(NC2CCN(C(=O)c3ccc(Cl)cc3)CC2)c(Cl)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C25H28Cl2N4O4/c26-19-7-5-18(6-8-19)25(33)31-12-10-20(11-13-31)29-24-21(27)15-17(16-28-24)4-9-22(32)30-35-23-3-1-2-14-34-23/h4-9,15-16,20,23H,1-3,10-14H2,(H,28,29)(H,30,32)/b9-4+ |
| InChIKey | JOMXXQDBVCVGFG-RUDMXATFSA-N |
| XLogP | 4.69 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|