C26H31ClN4O4 — CID 90802050
N-[3-[[3-chloro-5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]phenyl]cyclohexanecarboxamide (PubChem CID 90802050) has the molecular formula C26H31ClN4O4 and a molecular weight of 499.01 g/mol. Its IUPAC name is N-[3-[[3-chloro-5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[3-chloro-5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 90802050 |
| Molecular Formula | C26H31ClN4O4 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[3-[[3-chloro-5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(C=Cc1cnc(Nc2cccc(NC(=O)C3CCCCC3)c2)c(Cl)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C26H31ClN4O4/c27-22-15-18(12-13-23(32)31-35-24-11-4-5-14-34-24)17-28-25(22)29-20-9-6-10-21(16-20)30-26(33)19-7-2-1-3-8-19/h6,9-10,12-13,15-17,19,24H,1-5,7-8,11,14H2,(H,28,29)(H,30,33)(H,31,32) |
| InChIKey | OLHHEDDFUQMMAM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|