C29H27N5O4S — CID 42625971
4-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-N-[3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide (PubChem CID 42625971) has the molecular formula C29H27N5O4S and a molecular weight of 541.63 g/mol. Its IUPAC name is 4-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-N-[3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide.
| Compound Name | 4-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-N-[3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 42625971 |
| Molecular Formula | C29H27N5O4S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 4-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-N-[3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)Nc2cccc(Nc3nc(-c4cccnc4)cs3)c2)cc1)NOC1CCCCO1 |
| InChI | InChI=1S/C29H27N5O4S/c35-26(34-38-27-8-1-2-16-37-27)14-11-20-9-12-21(13-10-20)28(36)31-23-6-3-7-24(17-23)32-29-33-25(19-39-29)22-5-4-15-30-18-22/h3-7,9-15,17-19,27H,1-2,8,16H2,(H,31,36)(H,32,33)(H,34,35)/b14-11+ |
| InChIKey | HOGSDQGCQVLWSQ-SDNWHVSQSA-N |
| XLogP | 5.79 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|