C16H14N4O2S — CID 86665636
3-methoxy-4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzamide (PubChem CID 86665636) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is 3-methoxy-4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzamide.
| Compound Name | 3-methoxy-4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 86665636 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-methoxy-4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzamide |
| SMILES | COc1cc(C(N)=O)ccc1Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C16H14N4O2S/c1-22-14-7-10(15(17)21)4-5-12(14)19-16-20-13(9-23-16)11-3-2-6-18-8-11/h2-9H,1H3,(H2,17,21)(H,19,20) |
| InChIKey | NMFQUSKFRYUZDX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |