C14H14BrN5O2S2 — CID 87942240
3-[[4-(2-amino-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-4-methoxybenzamide;hydrobromide (PubChem CID 87942240) has the molecular formula C14H14BrN5O2S2 and a molecular weight of 428.34 g/mol. Its IUPAC name is 3-[[4-(2-amino-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-4-methoxybenzamide;hydrobromide.
| Compound Name | 3-[[4-(2-amino-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-4-methoxybenzamide;hydrobromide |
|---|---|
| PubChem CID | 87942240 |
| Molecular Formula | C14H14BrN5O2S2 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | 3-[[4-(2-amino-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-4-methoxybenzamide;hydrobromide |
| SMILES | Br.COc1ccc(C(N)=O)cc1Nc1nc(-c2cnc(N)s2)cs1 |
| InChI | InChI=1S/C14H13N5O2S2.BrH/c1-21-10-3-2-7(12(15)20)4-8(10)18-14-19-9(6-22-14)11-5-17-13(16)23-11;/h2-6H,1H3,(H2,15,20)(H2,16,17)(H,18,19);1H |
| InChIKey | QIAMZLLCWCPBNL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|