C7H7N3OS2 — CID 130571395
5-(2-methoxy-1,3-thiazol-4-yl)-1,3-thiazol-2-amine (PubChem CID 130571395) has the molecular formula C7H7N3OS2 and a molecular weight of 213.29 g/mol. Its IUPAC name is 5-(2-methoxy-1,3-thiazol-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2-methoxy-1,3-thiazol-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130571395 |
| Molecular Formula | C7H7N3OS2 |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 5-(2-methoxy-1,3-thiazol-4-yl)-1,3-thiazol-2-amine |
| SMILES | COc1nc(-c2cnc(N)s2)cs1 |
| InChI | InChI=1S/C7H7N3OS2/c1-11-7-10-4(3-12-7)5-2-9-6(8)13-5/h2-3H,1H3,(H2,8,9) |
| InChIKey | NQAUSDNELNOETG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |