C13H17NOS — CID 145078481
ethane;2-methoxy-4-(4-methylphenyl)-1,3-thiazole (PubChem CID 145078481) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is ethane;2-methoxy-4-(4-methylphenyl)-1,3-thiazole.
| Compound Name | ethane;2-methoxy-4-(4-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 145078481 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | ethane;2-methoxy-4-(4-methylphenyl)-1,3-thiazole |
| SMILES | CC.COc1nc(-c2ccc(C)cc2)cs1 |
| InChI | InChI=1S/C11H11NOS.C2H6/c1-8-3-5-9(6-4-8)10-7-14-11(12-10)13-2;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | DYCLEBVQWPBXAC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |