C11H9N3S — CID 16653105
[4-(4-methylphenyl)-1,3-thiazol-2-yl]cyanamide (PubChem CID 16653105) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is [4-(4-methylphenyl)-1,3-thiazol-2-yl]cyanamide.
| Compound Name | [4-(4-methylphenyl)-1,3-thiazol-2-yl]cyanamide |
|---|---|
| PubChem CID | 16653105 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | [4-(4-methylphenyl)-1,3-thiazol-2-yl]cyanamide |
| SMILES | Cc1ccc(-c2csc(NC#N)n2)cc1 |
| InChI | InChI=1S/C11H9N3S/c1-8-2-4-9(5-3-8)10-6-15-11(14-10)13-7-12/h2-6H,1H3,(H,13,14) |
| InChIKey | NZPMFCVONYEDMC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|