C15H9N5S — CID 10446997
2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]ethene-1,1,2-tricarbonitrile (PubChem CID 10446997) has the molecular formula C15H9N5S and a molecular weight of 291.34 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 10446997 |
| Molecular Formula | C15H9N5S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1ccc(-c2csc(NC(C#N)=C(C#N)C#N)n2)cc1 |
| InChI | InChI=1S/C15H9N5S/c1-10-2-4-11(5-3-10)14-9-21-15(20-14)19-13(8-18)12(6-16)7-17/h2-5,9H,1H3,(H,19,20) |
| InChIKey | WMHYMBRAJPMACC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|