C17H14FN3S2 — CID 134105058
1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)thiourea (PubChem CID 134105058) has the molecular formula C17H14FN3S2 and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 134105058 |
| Molecular Formula | C17H14FN3S2 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2nc(-c3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C17H14FN3S2/c1-11-2-8-14(9-3-11)19-16(22)21-17-20-15(10-23-17)12-4-6-13(18)7-5-12/h2-10H,1H3,(H2,19,20,21,22) |
| InChIKey | LQPVFUFRYFLYJN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|