C18H16FN3OS — CID 156772101
N-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]phenyl]propanamide (PubChem CID 156772101) has the molecular formula C18H16FN3OS and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]phenyl]propanamide.
| Compound Name | N-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 156772101 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(Nc2nc(-c3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H16FN3OS/c1-2-17(23)20-14-7-9-15(10-8-14)21-18-22-16(11-24-18)12-3-5-13(19)6-4-12/h3-11H,2H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | DUGFXEAONRZLTJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |