C20H16FN3O2S — CID 8502228
(E)-N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 8502228) has the molecular formula C20H16FN3O2S and a molecular weight of 381.43 g/mol. Its IUPAC name is (E)-N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8502228 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (E)-N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(NC(=O)/C=C/c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H16FN3O2S/c1-13(25)22-17-9-5-15(6-10-17)18-12-27-20(23-18)24-19(26)11-4-14-2-7-16(21)8-3-14/h2-12H,1H3,(H,22,25)(H,23,24,26)/b11-4+ |
| InChIKey | YDPWCYLMZMLDHU-NYYWCZLTSA-N |
| XLogP | 4.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|