C21H19N3O2S2 — CID 98674905
(E)-3-(4-acetamidophenyl)-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 98674905) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is (E)-3-(4-acetamidophenyl)-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-acetamidophenyl)-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 98674905 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (E)-3-(4-acetamidophenyl)-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CSc1ccc(-c2csc(NC(=O)/C=C/c3ccc(NC(C)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C21H19N3O2S2/c1-14(25)22-17-8-3-15(4-9-17)5-12-20(26)24-21-23-19(13-28-21)16-6-10-18(27-2)11-7-16/h3-13H,1-2H3,(H,22,25)(H,23,24,26)/b12-5+ |
| InChIKey | FRDMKTKDAIAZOL-LFYBBSHMSA-N |
| XLogP | 5.14 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|