C22H20FN3O2S — CID 46632684
(E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 46632684) has the molecular formula C22H20FN3O2S and a molecular weight of 409.49 g/mol. Its IUPAC name is (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46632684 |
| Molecular Formula | C22H20FN3O2S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | CC(=O)NC(C)c1ccc(-c2csc(NC(=O)/C=C/c3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C22H20FN3O2S/c1-14(24-15(2)27)17-7-9-18(10-8-17)20-13-29-22(25-20)26-21(28)11-6-16-4-3-5-19(23)12-16/h3-14H,1-2H3,(H,24,27)(H,25,26,28)/b11-6+ |
| InChIKey | RMJDNVFBSRXXSB-IZZDOVSWSA-N |
| XLogP | 4.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|