C24H25N3O4S — CID 55435010
(E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 55435010) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55435010 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)Nc2nc(-c3ccc(C(C)NC(C)=O)cc3)cs2)c1 |
| InChI | InChI=1S/C24H25N3O4S/c1-15(25-16(2)28)17-5-7-18(8-6-17)21-14-32-24(26-21)27-23(29)12-9-19-13-20(30-3)10-11-22(19)31-4/h5-15H,1-4H3,(H,25,28)(H,26,27,29)/b12-9+ |
| InChIKey | MQOMOXKODIKCEN-FMIVXFBMSA-N |
| XLogP | 4.68 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|