C24H23F2N3O4S — CID 46632612
(E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 46632612) has the molecular formula C24H23F2N3O4S and a molecular weight of 487.53 g/mol. Its IUPAC name is (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46632612 |
| Molecular Formula | C24H23F2N3O4S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (E)-N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nc(-c3ccc(C(C)NC(C)=O)cc3)cs2)ccc1OC(F)F |
| InChI | InChI=1S/C24H23F2N3O4S/c1-14(27-15(2)30)17-6-8-18(9-7-17)19-13-34-24(28-19)29-22(31)11-5-16-4-10-20(33-23(25)26)21(12-16)32-3/h4-14,23H,1-3H3,(H,27,30)(H,28,29,31)/b11-5+ |
| InChIKey | FTHFOGGJYOMPDL-VZUCSPMQSA-N |
| XLogP | 5.27 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|