C19H15BrN2OS — CID 7948149
(E)-3-(3-bromophenyl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 7948149) has the molecular formula C19H15BrN2OS and a molecular weight of 399.31 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 7948149 |
| Molecular Formula | C19H15BrN2OS |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)/C=C/c3cccc(Br)c3)n2)cc1 |
| InChI | InChI=1S/C19H15BrN2OS/c1-13-5-8-15(9-6-13)17-12-24-19(21-17)22-18(23)10-7-14-3-2-4-16(20)11-14/h2-12H,1H3,(H,21,22,23)/b10-7+ |
| InChIKey | LREQHURCOGHBPT-JXMROGBWSA-N |
| XLogP | 5.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|