C22H17N5S2 — CID 177435083
1-cyano-N,N'-bis[4-(4-methylphenyl)-1,3-thiazol-2-yl]methanimidamide (PubChem CID 177435083) has the molecular formula C22H17N5S2 and a molecular weight of 415.55 g/mol. Its IUPAC name is 1-cyano-N,N'-bis[4-(4-methylphenyl)-1,3-thiazol-2-yl]methanimidamide.
| Compound Name | 1-cyano-N,N'-bis[4-(4-methylphenyl)-1,3-thiazol-2-yl]methanimidamide |
|---|---|
| PubChem CID | 177435083 |
| Molecular Formula | C22H17N5S2 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 1-cyano-N,N'-bis[4-(4-methylphenyl)-1,3-thiazol-2-yl]methanimidamide |
| SMILES | Cc1ccc(-c2csc(/N=C(/C#N)Nc3nc(-c4ccc(C)cc4)cs3)n2)cc1 |
| InChI | InChI=1S/C22H17N5S2/c1-14-3-7-16(8-4-14)18-12-28-21(24-18)26-20(11-23)27-22-25-19(13-29-22)17-9-5-15(2)6-10-17/h3-10,12-13H,1-2H3,(H,24,25,26,27) |
| InChIKey | RPGUQBMVEJJMJO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|