C11H9N3S — CID 17446227
4-[2-(methylamino)-1,3-thiazol-4-yl]benzonitrile (PubChem CID 17446227) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 4-[2-(methylamino)-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-(methylamino)-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 17446227 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 4-[2-(methylamino)-1,3-thiazol-4-yl]benzonitrile |
| SMILES | CNc1nc(-c2ccc(C#N)cc2)cs1 |
| InChI | InChI=1S/C11H9N3S/c1-13-11-14-10(7-15-11)9-4-2-8(6-12)3-5-9/h2-5,7H,1H3,(H,13,14) |
| InChIKey | TYGNMCAGUHPZDD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |