C11H12N2OS — CID 164892281
5-(5-methoxy-2-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 164892281) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 5-(5-methoxy-2-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(5-methoxy-2-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 164892281 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 5-(5-methoxy-2-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(C)c(-c2cnc(N)s2)c1 |
| InChI | InChI=1S/C11H12N2OS/c1-7-3-4-8(14-2)5-9(7)10-6-13-11(12)15-10/h3-6H,1-2H3,(H2,12,13) |
| InChIKey | RWHIOACTGMOSBI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |