C11H11FN2S — CID 164892371
5-(2-fluoro-4,5-dimethylphenyl)-1,3-thiazol-2-amine (PubChem CID 164892371) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-(2-fluoro-4,5-dimethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2-fluoro-4,5-dimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 164892371 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 5-(2-fluoro-4,5-dimethylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(F)c(-c2cnc(N)s2)cc1C |
| InChI | InChI=1S/C11H11FN2S/c1-6-3-8(9(12)4-7(6)2)10-5-14-11(13)15-10/h3-5H,1-2H3,(H2,13,14) |
| InChIKey | LALCKKYUWVSNEJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |