C9H9N3S — CID 115375039
5-(5-methyl-3-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 115375039) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is 5-(5-methyl-3-pyridinyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(5-methyl-3-pyridinyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115375039 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 5-(5-methyl-3-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cncc(-c2cnc(N)s2)c1 |
| InChI | InChI=1S/C9H9N3S/c1-6-2-7(4-11-3-6)8-5-12-9(10)13-8/h2-5H,1H3,(H2,10,12) |
| InChIKey | JMKBHQNUYCQUKU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |