C11H14N2S — CID 142092018
ethane;5-phenyl-1,3-thiazol-2-amine (PubChem CID 142092018) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is ethane;5-phenyl-1,3-thiazol-2-amine.
| Compound Name | ethane;5-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 142092018 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethane;5-phenyl-1,3-thiazol-2-amine |
| SMILES | CC.Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C9H8N2S.C2H6/c10-9-11-6-8(12-9)7-4-2-1-3-5-7;1-2/h1-6H,(H2,10,11);1-2H3 |
| InChIKey | NMOGWCZSRYBOEW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |