About ethane;5-phenyl-1,3-thiazol-2-amine
ethane;5-phenyl-1,3-thiazol-2-amine (PubChem CID 142092018) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is ethane;5-phenyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | ethane;5-phenyl-1,3-thiazol-2-amine |
| PubChem CID | 142092018 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethane;5-phenyl-1,3-thiazol-2-amine |
| SMILES | CC.Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C9H8N2S.C2H6/c10-9-11-6-8(12-9)7-4-2-1-3-5-7;1-2/h1-6H,(H2,10,11);1-2H3 |
| InChIKey | NMOGWCZSRYBOEW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-phenyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-phenyl-1,3-thiazol-2-amine?
The IUPAC name of ethane;5-phenyl-1,3-thiazol-2-amine (CID 142092018) is ethane;5-phenyl-1,3-thiazol-2-amine.
What is the SMILES notation for ethane;5-phenyl-1,3-thiazol-2-amine?
The canonical SMILES for ethane;5-phenyl-1,3-thiazol-2-amine is CC.Nc1ncc(-c2ccccc2)s1.
What is the InChIKey of ethane;5-phenyl-1,3-thiazol-2-amine?
The InChIKey is NMOGWCZSRYBOEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S.C2H6/c10-9-11-6-8(12-9)7-4-2-1-3-5-7;1-2/h1-6H,(H2,10,11);1-2H3.
What are the key properties of ethane;5-phenyl-1,3-thiazol-2-amine?
ethane;5-phenyl-1,3-thiazol-2-amine has a molecular weight of 206.31 g/mol, XLogP of 3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-phenyl-1,3-thiazol-2-amine is sourced from PubChem (CID 142092018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).