C11H8N4OS — CID 83301136
5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-2-amine (PubChem CID 83301136) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83301136 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(-c2nnc(-c3ccccc3)o2)s1 |
| InChI | InChI=1S/C11H8N4OS/c12-11-13-6-8(17-11)10-15-14-9(16-10)7-4-2-1-3-5-7/h1-6H,(H2,12,13) |
| InChIKey | QYVJNGCQMMWYSX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |