C10H7N3S — CID 61025504
3-(2-amino-1,3-thiazol-5-yl)benzonitrile (PubChem CID 61025504) has the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-5-yl)benzonitrile.
| Compound Name | 3-(2-amino-1,3-thiazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 61025504 |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-5-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2cnc(N)s2)c1 |
| InChI | InChI=1S/C10H7N3S/c11-5-7-2-1-3-8(4-7)9-6-13-10(12)14-9/h1-4,6H,(H2,12,13) |
| InChIKey | SZVGPMNDMYZPAD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |