C18H10N2S — CID 71530393
3-thieno[3,2-c]quinolin-2-ylbenzonitrile (PubChem CID 71530393) has the molecular formula C18H10N2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-thieno[3,2-c]quinolin-2-ylbenzonitrile.
| Compound Name | 3-thieno[3,2-c]quinolin-2-ylbenzonitrile |
|---|---|
| PubChem CID | 71530393 |
| Molecular Formula | C18H10N2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-thieno[3,2-c]quinolin-2-ylbenzonitrile |
| SMILES | N#Cc1cccc(-c2cc3cnc4ccccc4c3s2)c1 |
| InChI | InChI=1S/C18H10N2S/c19-10-12-4-3-5-13(8-12)17-9-14-11-20-16-7-2-1-6-15(16)18(14)21-17/h1-9,11H |
| InChIKey | WABAORVAMKTDNX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |