C18H11N5S — CID 70901414
3-(4-amino-6-pyridin-2-ylthieno[2,3-d]pyrimidin-2-yl)benzonitrile (PubChem CID 70901414) has the molecular formula C18H11N5S and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-(4-amino-6-pyridin-2-ylthieno[2,3-d]pyrimidin-2-yl)benzonitrile.
| Compound Name | 3-(4-amino-6-pyridin-2-ylthieno[2,3-d]pyrimidin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 70901414 |
| Molecular Formula | C18H11N5S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-(4-amino-6-pyridin-2-ylthieno[2,3-d]pyrimidin-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nc(N)c3cc(-c4ccccn4)sc3n2)c1 |
| InChI | InChI=1S/C18H11N5S/c19-10-11-4-3-5-12(8-11)17-22-16(20)13-9-15(24-18(13)23-17)14-6-1-2-7-21-14/h1-9H,(H2,20,22,23) |
| InChIKey | XJZJPHWGFVLNTJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |