C14H9N5OS — CID 11594527
4-amino-2-(3-cyanophenyl)thieno[2,3-d]pyridazine-7-carboxamide (PubChem CID 11594527) has the molecular formula C14H9N5OS and a molecular weight of 295.33 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)thieno[2,3-d]pyridazine-7-carboxamide.
| Compound Name | 4-amino-2-(3-cyanophenyl)thieno[2,3-d]pyridazine-7-carboxamide |
|---|---|
| PubChem CID | 11594527 |
| Molecular Formula | C14H9N5OS |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)thieno[2,3-d]pyridazine-7-carboxamide |
| SMILES | N#Cc1cccc(-c2cc3c(N)nnc(C(N)=O)c3s2)c1 |
| InChI | InChI=1S/C14H9N5OS/c15-6-7-2-1-3-8(4-7)10-5-9-12(21-10)11(14(17)20)18-19-13(9)16/h1-5H,(H2,16,19)(H2,17,20) |
| InChIKey | AOJLCBVPQJIJTA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |