C16H12N4 — CID 3233618
3-[4-(methylamino)quinazolin-2-yl]benzonitrile (PubChem CID 3233618) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-[4-(methylamino)quinazolin-2-yl]benzonitrile.
| Compound Name | 3-[4-(methylamino)quinazolin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 3233618 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-[4-(methylamino)quinazolin-2-yl]benzonitrile |
| SMILES | CNc1nc(-c2cccc(C#N)c2)nc2ccccc12 |
| InChI | InChI=1S/C16H12N4/c1-18-16-13-7-2-3-8-14(13)19-15(20-16)12-6-4-5-11(9-12)10-17/h2-9H,1H3,(H,18,19,20) |
| InChIKey | GKKXDQMITYOQAS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |