C15H9N3S — CID 71530528
2-pyrimidin-5-ylthieno[3,2-c]quinoline (PubChem CID 71530528) has the molecular formula C15H9N3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-pyrimidin-5-ylthieno[3,2-c]quinoline.
| Compound Name | 2-pyrimidin-5-ylthieno[3,2-c]quinoline |
|---|---|
| PubChem CID | 71530528 |
| Molecular Formula | C15H9N3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-pyrimidin-5-ylthieno[3,2-c]quinoline |
| SMILES | c1ccc2c(c1)ncc1cc(-c3cncnc3)sc12 |
| InChI | InChI=1S/C15H9N3S/c1-2-4-13-12(3-1)15-10(8-18-13)5-14(19-15)11-6-16-9-17-7-11/h1-9H |
| InChIKey | XUMVXKUOROXGJR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |