About 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine
3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine (PubChem CID 59471915) has the molecular formula C24H17N5O
and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine |
| PubChem CID | 59471915 |
| Molecular Formula | C24H17N5O |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine |
| SMILES | Nc1ncc(-c2ccccc2-c2ccccc2)nc1-c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H17N5O/c25-22-21(24-29-28-23(30-24)17-11-5-2-6-12-17)27-20(15-26-22)19-14-8-7-13-18(19)16-9-3-1-4-10-16/h1-15H,(H2,25,26) |
| InChIKey | ATQTZSLFRXGNQI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine?
The IUPAC name of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine (CID 59471915) is 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine.
What is the SMILES notation for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine?
The canonical SMILES for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine is Nc1ncc(-c2ccccc2-c2ccccc2)nc1-c1nnc(-c2ccccc2)o1.
What is the InChIKey of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine?
The InChIKey is ATQTZSLFRXGNQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N5O/c25-22-21(24-29-28-23(30-24)17-11-5-2-6-12-17)27-20(15-26-22)19-14-8-7-13-18(19)16-9-3-1-4-10-16/h1-15H,(H2,25,26).
What are the key properties of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine?
3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine has a molecular weight of 391.43 g/mol, XLogP of 5.11, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-phenylphenyl)pyrazin-2-amine is sourced from PubChem (CID 59471915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).