C19H14N6O2 — CID 59471656
3-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]benzamide (PubChem CID 59471656) has the molecular formula C19H14N6O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is 3-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]benzamide.
| Compound Name | 3-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 59471656 |
| Molecular Formula | C19H14N6O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2cnc(N)c(-c3nnc(-c4ccccc4)o3)n2)c1 |
| InChI | InChI=1S/C19H14N6O2/c20-16-15(19-25-24-18(27-19)11-5-2-1-3-6-11)23-14(10-22-16)12-7-4-8-13(9-12)17(21)26/h1-10H,(H2,20,22)(H2,21,26) |
| InChIKey | WVUVZEGHNUZOLM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |