C9H5ClF2N2S — CID 107476819
5-(2-chloro-4,5-difluorophenyl)-1,3-thiazol-2-amine (PubChem CID 107476819) has the molecular formula C9H5ClF2N2S and a molecular weight of 246.67 g/mol. Its IUPAC name is 5-(2-chloro-4,5-difluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2-chloro-4,5-difluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107476819 |
| Molecular Formula | C9H5ClF2N2S |
| Molecular Weight | 246.67 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 5-(2-chloro-4,5-difluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(-c2cc(F)c(F)cc2Cl)s1 |
| InChI | InChI=1S/C9H5ClF2N2S/c10-5-2-7(12)6(11)1-4(5)8-3-14-9(13)15-8/h1-3H,(H2,13,14) |
| InChIKey | VDYRWGZQTASGEI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|