C7H5ClN2S2 — CID 107360465
5-(3-chlorothiophen-2-yl)-1,3-thiazol-2-amine (PubChem CID 107360465) has the molecular formula C7H5ClN2S2 and a molecular weight of 216.72 g/mol. Its IUPAC name is 5-(3-chlorothiophen-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-(3-chlorothiophen-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107360465 |
| Molecular Formula | C7H5ClN2S2 |
| Molecular Weight | 216.72 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | 5-(3-chlorothiophen-2-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(-c2sccc2Cl)s1 |
| InChI | InChI=1S/C7H5ClN2S2/c8-4-1-2-11-6(4)5-3-10-7(9)12-5/h1-3H,(H2,9,10) |
| InChIKey | GDHZWTXBPWKLQH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |