C7H6ClN5S — CID 112681516
6-(3-chlorothiophen-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681516) has the molecular formula C7H6ClN5S and a molecular weight of 227.68 g/mol. Its IUPAC name is 6-(3-chlorothiophen-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3-chlorothiophen-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681516 |
| Molecular Formula | C7H6ClN5S |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 6-(3-chlorothiophen-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2sccc2Cl)n1 |
| InChI | InChI=1S/C7H6ClN5S/c8-3-1-2-14-4(3)5-11-6(9)13-7(10)12-5/h1-2H,(H4,9,10,11,12,13) |
| InChIKey | RZTFETMOUSZUEM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |