C6H7N7S — CID 130568125
6-(2-amino-1,3-thiazol-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 130568125) has the molecular formula C6H7N7S and a molecular weight of 209.24 g/mol. Its IUPAC name is 6-(2-amino-1,3-thiazol-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-amino-1,3-thiazol-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130568125 |
| Molecular Formula | C6H7N7S |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-(2-amino-1,3-thiazol-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2csc(N)n2)n1 |
| InChI | InChI=1S/C6H7N7S/c7-4-11-3(12-5(8)13-4)2-1-14-6(9)10-2/h1H,(H2,9,10)(H4,7,8,11,12,13) |
| InChIKey | RPRKZNVYWBJQBL-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |