C9H6BrClN2S — CID 164892159
5-(3-bromo-5-chlorophenyl)-1,3-thiazol-2-amine (PubChem CID 164892159) has the molecular formula C9H6BrClN2S and a molecular weight of 289.59 g/mol. Its IUPAC name is 5-(3-bromo-5-chlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(3-bromo-5-chlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 164892159 |
| Molecular Formula | C9H6BrClN2S |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | 5-(3-bromo-5-chlorophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(-c2cc(Cl)cc(Br)c2)s1 |
| InChI | InChI=1S/C9H6BrClN2S/c10-6-1-5(2-7(11)3-6)8-4-13-9(12)14-8/h1-4H,(H2,12,13) |
| InChIKey | FXIBDEWTGRLUFF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |